2,4-Diethylhepta-2,6-dienal
Catalog No: FT-0694442
CAS No: 85136-07-8
- Chemical Name: 2,4-Diethylhepta-2,6-dienal
- Molecular Formula: C11H18O
- Molecular Weight: 166.26
- InChI Key: QAFGEOHWEQLURJ-DHZHZOJOSA-N
- InChI: InChI=1S/C11H18O/c1-4-7-10(5-2)8-11(6-3)9-12/h4,8-10H,1,5-7H2,2-3H3/b11-8+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,4-Diethyl-2,6-heptadienal, mixture of isomers |
|---|---|
| Flash_Point: | 86ºC |
| Melting_Point: | N/A |
| FW: | 166.26000 |
| Density: | 0.862 |
| CAS: | 85136-07-8 |
| Bolling_Point: | 91ºC (12 MMHG) |
| MF: | C11H18O |
| Density: | 0.862 |
|---|---|
| LogP: | 3.12400 |
| Flash_Point: | 86ºC |
| Refractive_Index: | 1.4676 |
| FW: | 166.26000 |
| PSA: | 17.07000 |
| MF: | C11H18O |
| Bolling_Point: | 91ºC (12 MMHG) |
| Exact_Mass: | 166.13600 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)